C21H24N2O7S2 — CID 4574356
[2-(4-methyl-2-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 4-oxo-4-thiophen-2-ylbutanoate (PubChem CID 4574356) has the molecular formula C21H24N2O7S2 and a molecular weight of 480.56 g/mol. Its IUPAC name is [2-(4-methyl-2-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 4-oxo-4-thiophen-2-ylbutanoate.
| Compound Name | [2-(4-methyl-2-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 4-oxo-4-thiophen-2-ylbutanoate |
|---|---|
| PubChem CID | 4574356 |
| Molecular Formula | C21H24N2O7S2 |
| Molecular Weight | 480.56 g/mol |
| Exact Mass | 480.10 |
| IUPAC Name | [2-(4-methyl-2-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 4-oxo-4-thiophen-2-ylbutanoate |
| SMILES | Cc1ccc(NC(=O)COC(=O)CCC(=O)c2cccs2)c(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C21H24N2O7S2/c1-15-4-5-16(19(13-15)32(27,28)23-8-10-29-11-9-23)22-20(25)14-30-21(26)7-6-17(24)18-3-2-12-31-18/h2-5,12-13H,6-11,14H2,1H3,(H,22,25) |
| InChIKey | HNLGCFHWYQBRSO-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.56 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |