C27H31N3O4S — CID 30038002
(E)-3-[4-(azepan-1-ylsulfonyl)phenyl]-N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-N-phenylprop-2-enamide (PubChem CID 30038002) has the molecular formula C27H31N3O4S and a molecular weight of 493.63 g/mol. Its IUPAC name is (E)-3-[4-(azepan-1-ylsulfonyl)phenyl]-N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-N-phenylprop-2-enamide.
| Compound Name | (E)-3-[4-(azepan-1-ylsulfonyl)phenyl]-N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-N-phenylprop-2-enamide |
|---|---|
| PubChem CID | 30038002 |
| Molecular Formula | C27H31N3O4S |
| Molecular Weight | 493.63 g/mol |
| Exact Mass | 493.20 |
| IUPAC Name | (E)-3-[4-(azepan-1-ylsulfonyl)phenyl]-N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-N-phenylprop-2-enamide |
| SMILES | Cc1noc(C)c1CN(C(=O)/C=C/c1ccc(S(=O)(=O)N2CCCCCC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C27H31N3O4S/c1-21-26(22(2)34-28-21)20-30(24-10-6-5-7-11-24)27(31)17-14-23-12-15-25(16-13-23)35(32,33)29-18-8-3-4-9-19-29/h5-7,10-17H,3-4,8-9,18-20H2,1-2H3/b17-14+ |
| InChIKey | NRQQKTIZSPHROZ-SAPNQHFASA-N |
| XLogP | 5.10 |
| TPSA | 83.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.63 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|