C12H11F3N4OS — CID 3004190
3-(5-sulfanylidene-1,2-dihydro-1,2,4-triazol-3-yl)-N-[3-(trifluoromethyl)phenyl]propanamide (PubChem CID 3004190) has the molecular formula C12H11F3N4OS and a molecular weight of 316.31 g/mol. Its IUPAC name is 3-(5-sulfanylidene-1,2-dihydro-1,2,4-triazol-3-yl)-N-[3-(trifluoromethyl)phenyl]propanamide.
| Compound Name | 3-(5-sulfanylidene-1,2-dihydro-1,2,4-triazol-3-yl)-N-[3-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 3004190 |
| Molecular Formula | C12H11F3N4OS |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | 3-(5-sulfanylidene-1,2-dihydro-1,2,4-triazol-3-yl)-N-[3-(trifluoromethyl)phenyl]propanamide |
| SMILES | O=C(CCc1nc(=S)[nH][nH]1)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H11F3N4OS/c13-12(14,15)7-2-1-3-8(6-7)16-10(20)5-4-9-17-11(21)19-18-9/h1-3,6H,4-5H2,(H,16,20)(H2,17,18,19,21) |
| InChIKey | VPBOXSVRNCVRNZ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 73.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|