C21H20N4O3S — CID 3004362
N-(4-acetylphenyl)-2-(carbamothioylhydrazinylidene)-4-oxo-6-phenylhex-5-enamide (PubChem CID 3004362) has the molecular formula C21H20N4O3S and a molecular weight of 408.48 g/mol. Its IUPAC name is N-(4-acetylphenyl)-2-(carbamothioylhydrazinylidene)-4-oxo-6-phenylhex-5-enamide.
| Compound Name | N-(4-acetylphenyl)-2-(carbamothioylhydrazinylidene)-4-oxo-6-phenylhex-5-enamide |
|---|---|
| PubChem CID | 3004362 |
| Molecular Formula | C21H20N4O3S |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | N-(4-acetylphenyl)-2-(carbamothioylhydrazinylidene)-4-oxo-6-phenylhex-5-enamide |
| SMILES | CC(=O)c1ccc(NC(=O)C(CC(=O)C=Cc2ccccc2)=NNC(N)=S)cc1 |
| InChI | InChI=1S/C21H20N4O3S/c1-14(26)16-8-10-17(11-9-16)23-20(28)19(24-25-21(22)29)13-18(27)12-7-15-5-3-2-4-6-15/h2-12H,13H2,1H3,(H,23,28)(H3,22,25,29) |
| InChIKey | VAXAVVZQELEXOO-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 113.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|