C11H11NO2S — CID 3004444
5,6,7-trimethyl-4-sulfanylidene-1,3-benzoxazin-2-one (PubChem CID 3004444) has the molecular formula C11H11NO2S and a molecular weight of 221.28 g/mol. Its IUPAC name is 5,6,7-trimethyl-4-sulfanylidene-1,3-benzoxazin-2-one.
| Compound Name | 5,6,7-trimethyl-4-sulfanylidene-1,3-benzoxazin-2-one |
|---|---|
| PubChem CID | 3004444 |
| Molecular Formula | C11H11NO2S |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.05 |
| IUPAC Name | 5,6,7-trimethyl-4-sulfanylidene-1,3-benzoxazin-2-one |
| SMILES | Cc1cc2oc(=O)[nH]c(=S)c2c(C)c1C |
| InChI | InChI=1S/C11H11NO2S/c1-5-4-8-9(7(3)6(5)2)10(15)12-11(13)14-8/h4H,1-3H3,(H,12,13,15) |
| InChIKey | SBRKWOZHWZAQRS-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 46.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|