C16H15NO2 — CID 30088193
(3aS,7aS)-1-(2-phenylethyl)-3a,7a-dihydroindole-2,3-dione (PubChem CID 30088193) has the molecular formula C16H15NO2 and a molecular weight of 253.30 g/mol. Its IUPAC name is (3aS,7aS)-1-(2-phenylethyl)-3a,7a-dihydroindole-2,3-dione.
| Compound Name | (3aS,7aS)-1-(2-phenylethyl)-3a,7a-dihydroindole-2,3-dione |
|---|---|
| PubChem CID | 30088193 |
| Molecular Formula | C16H15NO2 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | (3aS,7aS)-1-(2-phenylethyl)-3a,7a-dihydroindole-2,3-dione |
| SMILES | O=C1C(=O)N(CCc2ccccc2)[C@H]2C=CC=C[C@H]12 |
| InChI | InChI=1S/C16H15NO2/c18-15-13-8-4-5-9-14(13)17(16(15)19)11-10-12-6-2-1-3-7-12/h1-9,13-14H,10-11H2/t13-,14-/m0/s1 |
| InChIKey | QKBWRAHZDHESIC-KBPBESRZSA-N |
| XLogP | 1.75 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|