C18H18Cl2N4O2S — CID 3011196
4-chloro-N-[3-chloro-7-(3-methylbut-2-enylamino)-2H-indazol-5-yl]benzenesulfonamide (PubChem CID 3011196) has the molecular formula C18H18Cl2N4O2S and a molecular weight of 425.34 g/mol. Its IUPAC name is 4-chloro-N-[3-chloro-7-(3-methylbut-2-enylamino)-2H-indazol-5-yl]benzenesulfonamide.
| Compound Name | 4-chloro-N-[3-chloro-7-(3-methylbut-2-enylamino)-2H-indazol-5-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 3011196 |
| Molecular Formula | C18H18Cl2N4O2S |
| Molecular Weight | 425.34 g/mol |
| Exact Mass | 424.05 |
| IUPAC Name | 4-chloro-N-[3-chloro-7-(3-methylbut-2-enylamino)-2H-indazol-5-yl]benzenesulfonamide |
| SMILES | CC(C)=CCNc1cc(NS(=O)(=O)c2ccc(Cl)cc2)cc2c(Cl)[nH]nc12 |
| InChI | InChI=1S/C18H18Cl2N4O2S/c1-11(2)7-8-21-16-10-13(9-15-17(16)22-23-18(15)20)24-27(25,26)14-5-3-12(19)4-6-14/h3-7,9-10,21,24H,8H2,1-2H3,(H,22,23) |
| InChIKey | VXHQUMOJXJDXOX-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.34 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|