C12H16N2O5 — CID 3013164
1-[2-[[(2R,5S)-5-(hydroxymethyl)-2,5-dihydrofuran-2-yl]oxy]ethyl]-5-methylpyrimidine-2,4-dione (PubChem CID 3013164) has the molecular formula C12H16N2O5 and a molecular weight of 268.27 g/mol. Its IUPAC name is 1-[2-[[(2R,5S)-5-(hydroxymethyl)-2,5-dihydrofuran-2-yl]oxy]ethyl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[2-[[(2R,5S)-5-(hydroxymethyl)-2,5-dihydrofuran-2-yl]oxy]ethyl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 3013164 |
| Molecular Formula | C12H16N2O5 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 1-[2-[[(2R,5S)-5-(hydroxymethyl)-2,5-dihydrofuran-2-yl]oxy]ethyl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn(CCO[C@H]2C=C[C@@H](CO)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C12H16N2O5/c1-8-6-14(12(17)13-11(8)16)4-5-18-10-3-2-9(7-15)19-10/h2-3,6,9-10,15H,4-5,7H2,1H3,(H,13,16,17)/t9-,10+/m0/s1 |
| InChIKey | KCMLMUGUWHDMAH-VHSXEESVSA-N |
| XLogP | -0.86 |
| TPSA | 93.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|