C12H15N2O6P — CID 171628930
acetylene;[5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2,5-dihydrofuran-2-yl]oxymethylphosphonous acid (PubChem CID 171628930) has the molecular formula C12H15N2O6P and a molecular weight of 314.23 g/mol. Its IUPAC name is acetylene;[5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2,5-dihydrofuran-2-yl]oxymethylphosphonous acid.
| Compound Name | acetylene;[5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2,5-dihydrofuran-2-yl]oxymethylphosphonous acid |
|---|---|
| PubChem CID | 171628930 |
| Molecular Formula | C12H15N2O6P |
| Molecular Weight | 314.23 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | acetylene;[5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2,5-dihydrofuran-2-yl]oxymethylphosphonous acid |
| SMILES | C#C.Cc1cn(C2C=CC(OCP(O)O)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C10H13N2O6P.C2H2/c1-6-4-12(10(14)11-9(6)13)7-2-3-8(18-7)17-5-19(15)16;1-2/h2-4,7-8,15-16H,5H2,1H3,(H,11,13,14);1-2H |
| InChIKey | IBQAUTKYPSUISL-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 113.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.23 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|