C12H17N2O7P — CID 14861968
1-[(2R,5R)-5-(dimethoxyphosphorylmethoxy)-2,5-dihydrofuran-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 14861968) has the molecular formula C12H17N2O7P and a molecular weight of 332.25 g/mol. Its IUPAC name is 1-[(2R,5R)-5-(dimethoxyphosphorylmethoxy)-2,5-dihydrofuran-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,5R)-5-(dimethoxyphosphorylmethoxy)-2,5-dihydrofuran-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 14861968 |
| Molecular Formula | C12H17N2O7P |
| Molecular Weight | 332.25 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | 1-[(2R,5R)-5-(dimethoxyphosphorylmethoxy)-2,5-dihydrofuran-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | COP(=O)(CO[C@@H]1C=C[C@H](n2cc(C)c(=O)[nH]c2=O)O1)OC |
| InChI | InChI=1S/C12H17N2O7P/c1-8-6-14(12(16)13-11(8)15)9-4-5-10(21-9)20-7-22(17,18-2)19-3/h4-6,9-10H,7H2,1-3H3,(H,13,15,16)/t9-,10+/m1/s1 |
| InChIKey | OSXIQTQMSKWLOZ-ZJUUUORDSA-N |
| XLogP | 0.72 |
| TPSA | 108.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.25 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|