C16H18F17NO3 — CID 3022251
3-[(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoro-2-hydroxyundecyl)amino]pentane-1,5-diol (PubChem CID 3022251) has the molecular formula C16H18F17NO3 and a molecular weight of 595.29 g/mol. Its IUPAC name is 3-[(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoro-2-hydroxyundecyl)amino]pentane-1,5-diol.
| Compound Name | 3-[(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoro-2-hydroxyundecyl)amino]pentane-1,5-diol |
|---|---|
| PubChem CID | 3022251 |
| Molecular Formula | C16H18F17NO3 |
| Molecular Weight | 595.29 g/mol |
| Exact Mass | 595.10 |
| IUPAC Name | 3-[(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoro-2-hydroxyundecyl)amino]pentane-1,5-diol |
| SMILES | OCCC(CCO)NCC(O)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H18F17NO3/c17-9(18,5-8(37)6-34-7(1-3-35)2-4-36)10(19,20)11(21,22)12(23,24)13(25,26)14(27,28)15(29,30)16(31,32)33/h7-8,34-37H,1-6H2 |
| InChIKey | JFYMEYNQCZNIPV-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.29 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|