C21H18F27NO3 — CID 3023865
3-[[4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,15,15,15-tetracosafluoro-2-hydroxy-14-(trifluoromethyl)pentadecyl]amino]pentane-1,5-diol (PubChem CID 3023865) has the molecular formula C21H18F27NO3 and a molecular weight of 845.32 g/mol. Its IUPAC name is 3-[[4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,15,15,15-tetracosafluoro-2-hydroxy-14-(trifluoromethyl)pentadecyl]amino]pentane-1,5-diol.
| Compound Name | 3-[[4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,15,15,15-tetracosafluoro-2-hydroxy-14-(trifluoromethyl)pentadecyl]amino]pentane-1,5-diol |
|---|---|
| PubChem CID | 3023865 |
| Molecular Formula | C21H18F27NO3 |
| Molecular Weight | 845.32 g/mol |
| Exact Mass | 845.09 |
| IUPAC Name | 3-[[4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,15,15,15-tetracosafluoro-2-hydroxy-14-(trifluoromethyl)pentadecyl]amino]pentane-1,5-diol |
| SMILES | OCCC(CCO)NCC(O)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C21H18F27NO3/c22-9(23,5-8(52)6-49-7(1-3-50)2-4-51)11(25,26)13(29,30)15(33,34)17(37,38)19(41,42)18(39,40)16(35,36)14(31,32)12(27,28)10(24,20(43,44)45)21(46,47)48/h7-8,49-52H,1-6H2 |
| InChIKey | LYMWMCCLDAPJHG-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 845.32 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|