C19H18F23NO3 — CID 3023867
2-[[5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,14,14,14-icosafluoro-3-hydroxy-13-(trifluoromethyl)tetradecyl]amino]butane-1,4-diol (PubChem CID 3023867) has the molecular formula C19H18F23NO3 and a molecular weight of 745.31 g/mol. Its IUPAC name is 2-[[5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,14,14,14-icosafluoro-3-hydroxy-13-(trifluoromethyl)tetradecyl]amino]butane-1,4-diol.
| Compound Name | 2-[[5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,14,14,14-icosafluoro-3-hydroxy-13-(trifluoromethyl)tetradecyl]amino]butane-1,4-diol |
|---|---|
| PubChem CID | 3023867 |
| Molecular Formula | C19H18F23NO3 |
| Molecular Weight | 745.31 g/mol |
| Exact Mass | 745.09 |
| IUPAC Name | 2-[[5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,14,14,14-icosafluoro-3-hydroxy-13-(trifluoromethyl)tetradecyl]amino]butane-1,4-diol |
| SMILES | OCCC(CO)NCCC(O)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C19H18F23NO3/c20-9(21,5-8(46)1-3-43-7(6-45)2-4-44)11(23,24)13(27,28)15(31,32)17(35,36)16(33,34)14(29,30)12(25,26)10(22,18(37,38)39)19(40,41)42/h7-8,43-46H,1-6H2 |
| InChIKey | WYZYMKLYWLKNHA-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.31 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|