C20H19F25INO3 — CID 3022246
1,5-dihydroxypentan-3-yl-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,15-pentacosafluoro-2-hydroxypentadecyl)azanium iodide (PubChem CID 3022246) has the molecular formula C20H19F25INO3 and a molecular weight of 923.23 g/mol. Its IUPAC name is 1,5-dihydroxypentan-3-yl-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,15-pentacosafluoro-2-hydroxypentadecyl)azanium iodide.
| Compound Name | 1,5-dihydroxypentan-3-yl-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,15-pentacosafluoro-2-hydroxypentadecyl)azanium iodide |
|---|---|
| PubChem CID | 3022246 |
| Molecular Formula | C20H19F25INO3 |
| Molecular Weight | 923.23 g/mol |
| Exact Mass | 923.00 |
| IUPAC Name | 1,5-dihydroxypentan-3-yl-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,15-pentacosafluoro-2-hydroxypentadecyl)azanium iodide |
| SMILES | OCCC(CCO)[NH2+]CC(O)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.[I-] |
| InChI | InChI=1S/C20H18F25NO3.HI/c21-9(22,5-8(49)6-46-7(1-3-47)2-4-48)10(23,24)11(25,26)12(27,28)13(29,30)14(31,32)15(33,34)16(35,36)17(37,38)18(39,40)19(41,42)20(43,44)45;/h7-8,46-49H,1-6H2;1H |
| InChIKey | UCEPTCZMGJOLBX-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 77.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 923.23 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|