C18H18F21NO3 — CID 3022249
2-[[(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-henicosafluoro-2-hydroxytridecyl)amino]methyl]butane-1,4-diol (PubChem CID 3022249) has the molecular formula C18H18F21NO3 and a molecular weight of 695.30 g/mol. Its IUPAC name is 2-[[(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-henicosafluoro-2-hydroxytridecyl)amino]methyl]butane-1,4-diol.
| Compound Name | 2-[[(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-henicosafluoro-2-hydroxytridecyl)amino]methyl]butane-1,4-diol |
|---|---|
| PubChem CID | 3022249 |
| Molecular Formula | C18H18F21NO3 |
| Molecular Weight | 695.30 g/mol |
| Exact Mass | 695.10 |
| IUPAC Name | 2-[[(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-henicosafluoro-2-hydroxytridecyl)amino]methyl]butane-1,4-diol |
| SMILES | OCCC(CO)CNCC(O)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C18H18F21NO3/c19-9(20,3-8(43)5-40-4-7(6-42)1-2-41)10(21,22)11(23,24)12(25,26)13(27,28)14(29,30)15(31,32)16(33,34)17(35,36)18(37,38)39/h7-8,40-43H,1-6H2 |
| InChIKey | VTBMWIOGWZLCET-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.30 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|