C17H18F19NO3 — CID 3023869
3-[[4,4,5,5,6,6,7,7,8,8,9,9,10,11,11,11-hexadecafluoro-2-hydroxy-10-(trifluoromethyl)undecyl]amino]pentane-1,5-diol (PubChem CID 3023869) has the molecular formula C17H18F19NO3 and a molecular weight of 645.30 g/mol. Its IUPAC name is 3-[[4,4,5,5,6,6,7,7,8,8,9,9,10,11,11,11-hexadecafluoro-2-hydroxy-10-(trifluoromethyl)undecyl]amino]pentane-1,5-diol.
| Compound Name | 3-[[4,4,5,5,6,6,7,7,8,8,9,9,10,11,11,11-hexadecafluoro-2-hydroxy-10-(trifluoromethyl)undecyl]amino]pentane-1,5-diol |
|---|---|
| PubChem CID | 3023869 |
| Molecular Formula | C17H18F19NO3 |
| Molecular Weight | 645.30 g/mol |
| Exact Mass | 645.10 |
| IUPAC Name | 3-[[4,4,5,5,6,6,7,7,8,8,9,9,10,11,11,11-hexadecafluoro-2-hydroxy-10-(trifluoromethyl)undecyl]amino]pentane-1,5-diol |
| SMILES | OCCC(CCO)NCC(O)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C17H18F19NO3/c18-9(19,5-8(40)6-37-7(1-3-38)2-4-39)11(21,22)13(25,26)15(29,30)14(27,28)12(23,24)10(20,16(31,32)33)17(34,35)36/h7-8,37-40H,1-6H2 |
| InChIKey | JBGFRUZDRPASBA-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.30 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|