C17H30ClNO2 — CID 3032230
5-(3,4-dimethoxyphenyl)nonan-5-amine;hydrochloride (PubChem CID 3032230) has the molecular formula C17H30ClNO2 and a molecular weight of 315.89 g/mol. Its IUPAC name is 5-(3,4-dimethoxyphenyl)nonan-5-amine;hydrochloride.
| Compound Name | 5-(3,4-dimethoxyphenyl)nonan-5-amine;hydrochloride |
|---|---|
| PubChem CID | 3032230 |
| Molecular Formula | C17H30ClNO2 |
| Molecular Weight | 315.89 g/mol |
| Exact Mass | 315.20 |
| IUPAC Name | 5-(3,4-dimethoxyphenyl)nonan-5-amine;hydrochloride |
| SMILES | CCCCC(N)(CCCC)c1ccc(OC)c(OC)c1.Cl |
| InChI | InChI=1S/C17H29NO2.ClH/c1-5-7-11-17(18,12-8-6-2)14-9-10-15(19-3)16(13-14)20-4;/h9-10,13H,5-8,11-12,18H2,1-4H3;1H |
| InChIKey | JJXLNTNICRAGKH-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.89 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |