C13H22N2O — CID 3035253
1,1-dimethyl-3-(3-tricyclo[5.2.1.02,6]decanyl)urea (PubChem CID 3035253) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is 1,1-dimethyl-3-(3-tricyclo[5.2.1.02,6]decanyl)urea.
| Compound Name | 1,1-dimethyl-3-(3-tricyclo[5.2.1.02,6]decanyl)urea |
|---|---|
| PubChem CID | 3035253 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | 1,1-dimethyl-3-(3-tricyclo[5.2.1.02,6]decanyl)urea |
| SMILES | CN(C)C(=O)NC1CCC2C3CCC(C3)C12 |
| InChI | InChI=1S/C13H22N2O/c1-15(2)13(16)14-11-6-5-10-8-3-4-9(7-8)12(10)11/h8-12H,3-7H2,1-2H3,(H,14,16) |
| InChIKey | QOBMKVRRANLSMZ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |