acetic acid;tricyclo[4.4.0.02,8]decan-3-ol

C12H20O3 — CID 57368471

IUPACacetic acid;tricyclo[4.4.0.02,8]decan-3-ol
SMILESCC(=O)O.OC1CCC2CC3CCC2C13
InChIInChI=1S/C10H16O.C2H4O2/c11-9-4-2-6-5-7-1-3-8(6)10(7)9;1-2(3)4/h6-11H,1-5H2;1H3,(H,3,4)
InChIKeyLWLRYZOXOFFZMX-UHFFFAOYSA-N
MW212.29 g/mol
LogP1.89
Rot. Bonds

About acetic acid;tricyclo[4.4.0.02,8]decan-3-ol

acetic acid;tricyclo[4.4.0.02,8]decan-3-ol (PubChem CID 57368471) has the molecular formula C12H20O3 and a molecular weight of 212.29 g/mol. Its IUPAC name is acetic acid;tricyclo[4.4.0.02,8]decan-3-ol.

Molecular Properties

Compound Nameacetic acid;tricyclo[4.4.0.02,8]decan-3-ol
PubChem CID57368471
Molecular FormulaC12H20O3
Molecular Weight212.29 g/mol
Exact Mass212.14
IUPAC Nameacetic acid;tricyclo[4.4.0.02,8]decan-3-ol
SMILESCC(=O)O.OC1CCC2CC3CCC2C13
InChIInChI=1S/C10H16O.C2H4O2/c11-9-4-2-6-5-7-1-3-8(6)10(7)9;1-2(3)4/h6-11H,1-5H2;1H3,(H,3,4)
InChIKeyLWLRYZOXOFFZMX-UHFFFAOYSA-N
XLogP1.89
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500212.29
LogP ≤ 51.89
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze acetic acid;tricyclo[4.4.0.02,8]decan-3-ol with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of acetic acid;tricyclo[4.4.0.02,8]decan-3-ol?
The IUPAC name of acetic acid;tricyclo[4.4.0.02,8]decan-3-ol (CID 57368471) is acetic acid;tricyclo[4.4.0.02,8]decan-3-ol.
What is the SMILES notation for acetic acid;tricyclo[4.4.0.02,8]decan-3-ol?
The canonical SMILES for acetic acid;tricyclo[4.4.0.02,8]decan-3-ol is CC(=O)O.OC1CCC2CC3CCC2C13.
What is the InChIKey of acetic acid;tricyclo[4.4.0.02,8]decan-3-ol?
The InChIKey is LWLRYZOXOFFZMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O.C2H4O2/c11-9-4-2-6-5-7-1-3-8(6)10(7)9;1-2(3)4/h6-11H,1-5H2;1H3,(H,3,4).
What are the key properties of acetic acid;tricyclo[4.4.0.02,8]decan-3-ol?
acetic acid;tricyclo[4.4.0.02,8]decan-3-ol has a molecular weight of 212.29 g/mol, XLogP of 1.89, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;tricyclo[4.4.0.02,8]decan-3-ol is sourced from PubChem (CID 57368471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).