C19H17Cl2N5O3S — CID 3038446
1-[[2-(6,8-dichloro-2-methyl-4-oxoquinazolin-3-yl)acetyl]amino]-3-(4-methoxyphenyl)thiourea (PubChem CID 3038446) has the molecular formula C19H17Cl2N5O3S and a molecular weight of 466.35 g/mol. Its IUPAC name is 1-[[2-(6,8-dichloro-2-methyl-4-oxoquinazolin-3-yl)acetyl]amino]-3-(4-methoxyphenyl)thiourea.
| Compound Name | 1-[[2-(6,8-dichloro-2-methyl-4-oxoquinazolin-3-yl)acetyl]amino]-3-(4-methoxyphenyl)thiourea |
|---|---|
| PubChem CID | 3038446 |
| Molecular Formula | C19H17Cl2N5O3S |
| Molecular Weight | 466.35 g/mol |
| Exact Mass | 465.04 |
| IUPAC Name | 1-[[2-(6,8-dichloro-2-methyl-4-oxoquinazolin-3-yl)acetyl]amino]-3-(4-methoxyphenyl)thiourea |
| SMILES | COc1ccc(NC(=S)NNC(=O)Cn2c(C)nc3c(Cl)cc(Cl)cc3c2=O)cc1 |
| InChI | InChI=1S/C19H17Cl2N5O3S/c1-10-22-17-14(7-11(20)8-15(17)21)18(28)26(10)9-16(27)24-25-19(30)23-12-3-5-13(29-2)6-4-12/h3-8H,9H2,1-2H3,(H,24,27)(H2,23,25,30) |
| InChIKey | ICOFVKYQIAAYCA-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 97.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.35 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|