C19H17Cl2N5O2S — CID 21151455
1-[[2-(6,8-dichloro-2-methyl-4-oxoquinazolin-3-yl)acetyl]amino]-3-(4-methylphenyl)thiourea (PubChem CID 21151455) has the molecular formula C19H17Cl2N5O2S and a molecular weight of 450.35 g/mol. Its IUPAC name is 1-[[2-(6,8-dichloro-2-methyl-4-oxoquinazolin-3-yl)acetyl]amino]-3-(4-methylphenyl)thiourea.
| Compound Name | 1-[[2-(6,8-dichloro-2-methyl-4-oxoquinazolin-3-yl)acetyl]amino]-3-(4-methylphenyl)thiourea |
|---|---|
| PubChem CID | 21151455 |
| Molecular Formula | C19H17Cl2N5O2S |
| Molecular Weight | 450.35 g/mol |
| Exact Mass | 449.05 |
| IUPAC Name | 1-[[2-(6,8-dichloro-2-methyl-4-oxoquinazolin-3-yl)acetyl]amino]-3-(4-methylphenyl)thiourea |
| SMILES | Cc1ccc(NC(=S)NNC(=O)Cn2c(C)nc3c(Cl)cc(Cl)cc3c2=O)cc1 |
| InChI | InChI=1S/C19H17Cl2N5O2S/c1-10-3-5-13(6-4-10)23-19(29)25-24-16(27)9-26-11(2)22-17-14(18(26)28)7-12(20)8-15(17)21/h3-8H,9H2,1-2H3,(H,24,27)(H2,23,25,29) |
| InChIKey | JHFFVTBJQATTHE-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 88.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.35 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|