C26H37BrN2O4 — CID 3039959
diethyl-methyl-[2-[4-[(2-pentan-3-yloxybenzoyl)amino]benzoyl]oxyethyl]azanium bromide (PubChem CID 3039959) has the molecular formula C26H37BrN2O4 and a molecular weight of 521.50 g/mol. Its IUPAC name is diethyl-methyl-[2-[4-[(2-pentan-3-yloxybenzoyl)amino]benzoyl]oxyethyl]azanium bromide.
| Compound Name | diethyl-methyl-[2-[4-[(2-pentan-3-yloxybenzoyl)amino]benzoyl]oxyethyl]azanium bromide |
|---|---|
| PubChem CID | 3039959 |
| Molecular Formula | C26H37BrN2O4 |
| Molecular Weight | 521.50 g/mol |
| Exact Mass | 520.19 |
| IUPAC Name | diethyl-methyl-[2-[4-[(2-pentan-3-yloxybenzoyl)amino]benzoyl]oxyethyl]azanium bromide |
| SMILES | CCC(CC)Oc1ccccc1C(=O)Nc1ccc(C(=O)OCC[N+](C)(CC)CC)cc1.[Br-] |
| InChI | InChI=1S/C26H36N2O4.BrH/c1-6-22(7-2)32-24-13-11-10-12-23(24)25(29)27-21-16-14-20(15-17-21)26(30)31-19-18-28(5,8-3)9-4;/h10-17,22H,6-9,18-19H2,1-5H3;1H |
| InChIKey | OHZDCXFTEKCMSX-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.50 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|