C31H49N2O5+ — CID 154676521
diethyl-methyl-[2-[4-[[2-(2,2,4,4-tetramethylpentoxy)benzoyl]amino]benzoyl]oxyethyl]azanium;methanol (PubChem CID 154676521) has the molecular formula C31H49N2O5+ and a molecular weight of 529.74 g/mol. Its IUPAC name is diethyl-methyl-[2-[4-[[2-(2,2,4,4-tetramethylpentoxy)benzoyl]amino]benzoyl]oxyethyl]azanium;methanol.
| Compound Name | diethyl-methyl-[2-[4-[[2-(2,2,4,4-tetramethylpentoxy)benzoyl]amino]benzoyl]oxyethyl]azanium;methanol |
|---|---|
| PubChem CID | 154676521 |
| Molecular Formula | C31H49N2O5+ |
| Molecular Weight | 529.74 g/mol |
| Exact Mass | 529.36 |
| IUPAC Name | diethyl-methyl-[2-[4-[[2-(2,2,4,4-tetramethylpentoxy)benzoyl]amino]benzoyl]oxyethyl]azanium;methanol |
| SMILES | CC[N+](C)(CC)CCOC(=O)c1ccc(NC(=O)c2ccccc2OCC(C)(C)CC(C)(C)C)cc1.CO |
| InChI | InChI=1S/C30H44N2O4.CH4O/c1-9-32(8,10-2)19-20-35-28(34)23-15-17-24(18-16-23)31-27(33)25-13-11-12-14-26(25)36-22-30(6,7)21-29(3,4)5;1-2/h11-18H,9-10,19-22H2,1-8H3;2H,1H3/p+1 |
| InChIKey | MGPPWWDRBMMPMB-UHFFFAOYSA-O |
| XLogP | 6.03 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.74 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|