C21H26N4S — CID 3043868
N,N-diethylethanamine;5,6-diphenyl-2H-1,2,4-triazine-3-thione (PubChem CID 3043868) has the molecular formula C21H26N4S and a molecular weight of 366.53 g/mol. Its IUPAC name is N,N-diethylethanamine;5,6-diphenyl-2H-1,2,4-triazine-3-thione.
| Compound Name | N,N-diethylethanamine;5,6-diphenyl-2H-1,2,4-triazine-3-thione |
|---|---|
| PubChem CID | 3043868 |
| Molecular Formula | C21H26N4S |
| Molecular Weight | 366.53 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | N,N-diethylethanamine;5,6-diphenyl-2H-1,2,4-triazine-3-thione |
| SMILES | CCN(CC)CC.S=c1nc(-c2ccccc2)c(-c2ccccc2)n[nH]1 |
| InChI | InChI=1S/C15H11N3S.C6H15N/c19-15-16-13(11-7-3-1-4-8-11)14(17-18-15)12-9-5-2-6-10-12;1-4-7(5-2)6-3/h1-10H,(H,16,18,19);4-6H2,1-3H3 |
| InChIKey | GYZIAUMBEMHOIG-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.53 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|