C13H17NO2S — CID 30470588
5-[2-(3-methoxyphenoxy)ethylsulfanyl]-3,4-dihydro-2H-pyrrole (PubChem CID 30470588) has the molecular formula C13H17NO2S and a molecular weight of 251.35 g/mol. Its IUPAC name is 5-[2-(3-methoxyphenoxy)ethylsulfanyl]-3,4-dihydro-2H-pyrrole.
| Compound Name | 5-[2-(3-methoxyphenoxy)ethylsulfanyl]-3,4-dihydro-2H-pyrrole |
|---|---|
| PubChem CID | 30470588 |
| Molecular Formula | C13H17NO2S |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.10 |
| IUPAC Name | 5-[2-(3-methoxyphenoxy)ethylsulfanyl]-3,4-dihydro-2H-pyrrole |
| SMILES | COc1cccc(OCCSC2=NCCC2)c1 |
| InChI | InChI=1S/C13H17NO2S/c1-15-11-4-2-5-12(10-11)16-8-9-17-13-6-3-7-14-13/h2,4-5,10H,3,6-9H2,1H3 |
| InChIKey | GMRHKNPYZYGHNV-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|