C22H25N3O4S2 — CID 30501163
N-[4-(diethylamino)-3-[(2-methoxyphenyl)sulfamoyl]phenyl]thiophene-3-carboxamide (PubChem CID 30501163) has the molecular formula C22H25N3O4S2 and a molecular weight of 459.59 g/mol. Its IUPAC name is N-[4-(diethylamino)-3-[(2-methoxyphenyl)sulfamoyl]phenyl]thiophene-3-carboxamide.
| Compound Name | N-[4-(diethylamino)-3-[(2-methoxyphenyl)sulfamoyl]phenyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 30501163 |
| Molecular Formula | C22H25N3O4S2 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.13 |
| IUPAC Name | N-[4-(diethylamino)-3-[(2-methoxyphenyl)sulfamoyl]phenyl]thiophene-3-carboxamide |
| SMILES | CCN(CC)c1ccc(NC(=O)c2ccsc2)cc1S(=O)(=O)Nc1ccccc1OC |
| InChI | InChI=1S/C22H25N3O4S2/c1-4-25(5-2)19-11-10-17(23-22(26)16-12-13-30-15-16)14-21(19)31(27,28)24-18-8-6-7-9-20(18)29-3/h6-15,24H,4-5H2,1-3H3,(H,23,26) |
| InChIKey | VVQJWTUOQJOHJL-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|