C21H18ClN3O3 — CID 3053156
1-(3-chloro-4-methylphenyl)-3-(2-methyl-4-oxoquinazolin-3-yl)piperidine-2,6-dione (PubChem CID 3053156) has the molecular formula C21H18ClN3O3 and a molecular weight of 395.85 g/mol. Its IUPAC name is 1-(3-chloro-4-methylphenyl)-3-(2-methyl-4-oxoquinazolin-3-yl)piperidine-2,6-dione.
| Compound Name | 1-(3-chloro-4-methylphenyl)-3-(2-methyl-4-oxoquinazolin-3-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 3053156 |
| Molecular Formula | C21H18ClN3O3 |
| Molecular Weight | 395.85 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | 1-(3-chloro-4-methylphenyl)-3-(2-methyl-4-oxoquinazolin-3-yl)piperidine-2,6-dione |
| SMILES | Cc1ccc(N2C(=O)CCC(n3c(C)nc4ccccc4c3=O)C2=O)cc1Cl |
| InChI | InChI=1S/C21H18ClN3O3/c1-12-7-8-14(11-16(12)22)25-19(26)10-9-18(21(25)28)24-13(2)23-17-6-4-3-5-15(17)20(24)27/h3-8,11,18H,9-10H2,1-2H3 |
| InChIKey | COPSVUTZPKLNEY-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 72.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.85 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|