C13H15N2O2+ — CID 3054525
(1,2-dimethylquinolin-1-ium-8-yl) N-methylcarbamate (PubChem CID 3054525) has the molecular formula C13H15N2O2+ and a molecular weight of 231.28 g/mol. Its IUPAC name is (1,2-dimethylquinolin-1-ium-8-yl) N-methylcarbamate.
| Compound Name | (1,2-dimethylquinolin-1-ium-8-yl) N-methylcarbamate |
|---|---|
| PubChem CID | 3054525 |
| Molecular Formula | C13H15N2O2+ |
| Molecular Weight | 231.28 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | (1,2-dimethylquinolin-1-ium-8-yl) N-methylcarbamate |
| SMILES | CNC(=O)Oc1cccc2ccc(C)[n+](C)c12 |
| InChI | InChI=1S/C13H14N2O2/c1-9-7-8-10-5-4-6-11(12(10)15(9)3)17-13(16)14-2/h4-8H,1-3H3/p+1 |
| InChIKey | SNWVGXUFRQDQFI-UHFFFAOYSA-O |
| XLogP | 1.69 |
| TPSA | 42.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.28 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|