C27H37N5O3 — CID 30620277
(2R)-N-(9-ethylcarbazol-3-yl)-2-[4-[2-(3-methoxypropylamino)-2-oxoethyl]piperazin-1-yl]propanamide (PubChem CID 30620277) has the molecular formula C27H37N5O3 and a molecular weight of 479.63 g/mol. Its IUPAC name is (2R)-N-(9-ethylcarbazol-3-yl)-2-[4-[2-(3-methoxypropylamino)-2-oxoethyl]piperazin-1-yl]propanamide.
| Compound Name | (2R)-N-(9-ethylcarbazol-3-yl)-2-[4-[2-(3-methoxypropylamino)-2-oxoethyl]piperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 30620277 |
| Molecular Formula | C27H37N5O3 |
| Molecular Weight | 479.63 g/mol |
| Exact Mass | 479.29 |
| IUPAC Name | (2R)-N-(9-ethylcarbazol-3-yl)-2-[4-[2-(3-methoxypropylamino)-2-oxoethyl]piperazin-1-yl]propanamide |
| SMILES | CCn1c2ccccc2c2cc(NC(=O)[C@@H](C)N3CCN(CC(=O)NCCCOC)CC3)ccc21 |
| InChI | InChI=1S/C27H37N5O3/c1-4-32-24-9-6-5-8-22(24)23-18-21(10-11-25(23)32)29-27(34)20(2)31-15-13-30(14-16-31)19-26(33)28-12-7-17-35-3/h5-6,8-11,18,20H,4,7,12-17,19H2,1-3H3,(H,28,33)(H,29,34)/t20-/m1/s1 |
| InChIKey | PKEVVLMHTQKGDX-HXUWFJFHSA-N |
| XLogP | 2.91 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.63 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|