C12H12N2O3 — CID 3067322
N-(5-methoxy-7,8-dihydro-1H-pyrano[2,3-g]indol-9-ylidene)hydroxylamine (PubChem CID 3067322) has the molecular formula C12H12N2O3 and a molecular weight of 232.24 g/mol. Its IUPAC name is N-(5-methoxy-7,8-dihydro-1H-pyrano[2,3-g]indol-9-ylidene)hydroxylamine.
| Compound Name | N-(5-methoxy-7,8-dihydro-1H-pyrano[2,3-g]indol-9-ylidene)hydroxylamine |
|---|---|
| PubChem CID | 3067322 |
| Molecular Formula | C12H12N2O3 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | N-(5-methoxy-7,8-dihydro-1H-pyrano[2,3-g]indol-9-ylidene)hydroxylamine |
| SMILES | COc1cc2cc[nH]c2c2c1OCCC2=NO |
| InChI | InChI=1S/C12H12N2O3/c1-16-9-6-7-2-4-13-11(7)10-8(14-15)3-5-17-12(9)10/h2,4,6,13,15H,3,5H2,1H3 |
| InChIKey | UWKVYNNYMWVHHP-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|