C13H15N3O3S2 — CID 30710981
N-(3-methyl-1,3-thiazol-2-ylidene)-3-(4-sulfamoylphenyl)propanamide (PubChem CID 30710981) has the molecular formula C13H15N3O3S2 and a molecular weight of 325.42 g/mol. Its IUPAC name is N-(3-methyl-1,3-thiazol-2-ylidene)-3-(4-sulfamoylphenyl)propanamide.
| Compound Name | N-(3-methyl-1,3-thiazol-2-ylidene)-3-(4-sulfamoylphenyl)propanamide |
|---|---|
| PubChem CID | 30710981 |
| Molecular Formula | C13H15N3O3S2 |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | N-(3-methyl-1,3-thiazol-2-ylidene)-3-(4-sulfamoylphenyl)propanamide |
| SMILES | Cn1ccs/c1=N/C(=O)CCc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C13H15N3O3S2/c1-16-8-9-20-13(16)15-12(17)7-4-10-2-5-11(6-3-10)21(14,18)19/h2-3,5-6,8-9H,4,7H2,1H3,(H2,14,18,19)/b15-13+ |
| InChIKey | LJTWKPRINQMZLH-FYWRMAATSA-N |
| XLogP | 0.79 |
| TPSA | 94.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |