C12H13N3O4S — CID 54351421
4-(4-diazo-3,5-dioxohexyl)benzenesulfonamide (PubChem CID 54351421) has the molecular formula C12H13N3O4S and a molecular weight of 295.32 g/mol. Its IUPAC name is 4-(4-diazo-3,5-dioxohexyl)benzenesulfonamide.
| Compound Name | 4-(4-diazo-3,5-dioxohexyl)benzenesulfonamide |
|---|---|
| PubChem CID | 54351421 |
| Molecular Formula | C12H13N3O4S |
| Molecular Weight | 295.32 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | 4-(4-diazo-3,5-dioxohexyl)benzenesulfonamide |
| SMILES | CC(=O)C(=[N+]=[N-])C(=O)CCc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C12H13N3O4S/c1-8(16)12(15-13)11(17)7-4-9-2-5-10(6-3-9)20(14,18)19/h2-3,5-6H,4,7H2,1H3,(H2,14,18,19) |
| InChIKey | UGAVZRVPHWNZJS-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 130.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.32 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|