C19H24N4O2S — CID 30740336
4-[3-[4-(thiophen-3-ylmethyl)piperazin-1-yl]propanoylamino]benzamide (PubChem CID 30740336) has the molecular formula C19H24N4O2S and a molecular weight of 372.49 g/mol. Its IUPAC name is 4-[3-[4-(thiophen-3-ylmethyl)piperazin-1-yl]propanoylamino]benzamide.
| Compound Name | 4-[3-[4-(thiophen-3-ylmethyl)piperazin-1-yl]propanoylamino]benzamide |
|---|---|
| PubChem CID | 30740336 |
| Molecular Formula | C19H24N4O2S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | 4-[3-[4-(thiophen-3-ylmethyl)piperazin-1-yl]propanoylamino]benzamide |
| SMILES | NC(=O)c1ccc(NC(=O)CCN2CCN(Cc3ccsc3)CC2)cc1 |
| InChI | InChI=1S/C19H24N4O2S/c20-19(25)16-1-3-17(4-2-16)21-18(24)5-7-22-8-10-23(11-9-22)13-15-6-12-26-14-15/h1-4,6,12,14H,5,7-11,13H2,(H2,20,25)(H,21,24) |
| InChIKey | CANYEPYDJWJRJL-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |