C22H23N3O3S2 — CID 30750168
(3S,7aS)-5-oxo-7a-phenyl-N'-(4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl)-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carbohydrazide (PubChem CID 30750168) has the molecular formula C22H23N3O3S2 and a molecular weight of 441.58 g/mol. Its IUPAC name is (3S,7aS)-5-oxo-7a-phenyl-N'-(4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl)-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carbohydrazide.
| Compound Name | (3S,7aS)-5-oxo-7a-phenyl-N'-(4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl)-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carbohydrazide |
|---|---|
| PubChem CID | 30750168 |
| Molecular Formula | C22H23N3O3S2 |
| Molecular Weight | 441.58 g/mol |
| Exact Mass | 441.12 |
| IUPAC Name | (3S,7aS)-5-oxo-7a-phenyl-N'-(4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl)-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carbohydrazide |
| SMILES | O=C(NNC(=O)[C@H]1CS[C@]2(c3ccccc3)CCC(=O)N12)c1cc2c(s1)CCCC2 |
| InChI | InChI=1S/C22H23N3O3S2/c26-19-10-11-22(15-7-2-1-3-8-15)25(19)16(13-29-22)20(27)23-24-21(28)18-12-14-6-4-5-9-17(14)30-18/h1-3,7-8,12,16H,4-6,9-11,13H2,(H,23,27)(H,24,28)/t16-,22+/m1/s1 |
| InChIKey | KVMWBDSRAGEPTD-ZHRRBRCNSA-N |
| XLogP | 2.98 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.58 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|