C10H10F3N3O3S2 — CID 3076380
2-[2-imino-6-(trifluoromethoxy)-1,3-benzothiazol-3-yl]ethanesulfonamide (PubChem CID 3076380) has the molecular formula C10H10F3N3O3S2 and a molecular weight of 341.34 g/mol. Its IUPAC name is 2-[2-imino-6-(trifluoromethoxy)-1,3-benzothiazol-3-yl]ethanesulfonamide.
| Compound Name | 2-[2-imino-6-(trifluoromethoxy)-1,3-benzothiazol-3-yl]ethanesulfonamide |
|---|---|
| PubChem CID | 3076380 |
| Molecular Formula | C10H10F3N3O3S2 |
| Molecular Weight | 341.34 g/mol |
| Exact Mass | 341.01 |
| IUPAC Name | 2-[2-imino-6-(trifluoromethoxy)-1,3-benzothiazol-3-yl]ethanesulfonamide |
| SMILES | [H]/N=c1\sc2cc(OC(F)(F)F)ccc2n1CCS(N)(=O)=O |
| InChI | InChI=1S/C10H10F3N3O3S2/c11-10(12,13)19-6-1-2-7-8(5-6)20-9(14)16(7)3-4-21(15,17)18/h1-2,5,14H,3-4H2,(H2,15,17,18)/b14-9- |
| InChIKey | RBIOHUQDHQKBQM-ZROIWOOFSA-N |
| XLogP | 1.37 |
| TPSA | 98.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.34 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |