C11H11F3N2OS — CID 3076403
3-propyl-6-(trifluoromethoxy)-1,3-benzothiazol-2-imine (PubChem CID 3076403) has the molecular formula C11H11F3N2OS and a molecular weight of 276.28 g/mol. Its IUPAC name is 3-propyl-6-(trifluoromethoxy)-1,3-benzothiazol-2-imine.
| Compound Name | 3-propyl-6-(trifluoromethoxy)-1,3-benzothiazol-2-imine |
|---|---|
| PubChem CID | 3076403 |
| Molecular Formula | C11H11F3N2OS |
| Molecular Weight | 276.28 g/mol |
| Exact Mass | 276.05 |
| IUPAC Name | 3-propyl-6-(trifluoromethoxy)-1,3-benzothiazol-2-imine |
| SMILES | [H]/N=c1\sc2cc(OC(F)(F)F)ccc2n1CCC |
| InChI | InChI=1S/C11H11F3N2OS/c1-2-5-16-8-4-3-7(17-11(12,13)14)6-9(8)18-10(16)15/h3-4,6,15H,2,5H2,1H3/b15-10- |
| InChIKey | GJQIWTDIPOZSCM-GDNBJRDFSA-N |
| XLogP | 3.49 |
| TPSA | 38.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.28 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |