C10H18ClNO3 — CID 3076649
2-[2-(dimethylamino)ethoxy]-1-(furan-3-yl)ethanol;hydrochloride (PubChem CID 3076649) has the molecular formula C10H18ClNO3 and a molecular weight of 235.71 g/mol. Its IUPAC name is 2-[2-(dimethylamino)ethoxy]-1-(furan-3-yl)ethanol;hydrochloride.
| Compound Name | 2-[2-(dimethylamino)ethoxy]-1-(furan-3-yl)ethanol;hydrochloride |
|---|---|
| PubChem CID | 3076649 |
| Molecular Formula | C10H18ClNO3 |
| Molecular Weight | 235.71 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 2-[2-(dimethylamino)ethoxy]-1-(furan-3-yl)ethanol;hydrochloride |
| SMILES | CN(C)CCOCC(O)c1ccoc1.Cl |
| InChI | InChI=1S/C10H17NO3.ClH/c1-11(2)4-6-14-8-10(12)9-3-5-13-7-9;/h3,5,7,10,12H,4,6,8H2,1-2H3;1H |
| InChIKey | UZVYBKCMUOZXAJ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 45.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.71 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|