About 3-aminopropanoyl (2S)-2-amino-3-(1-methylimidazol-4-yl)propanoate
3-aminopropanoyl (2S)-2-amino-3-(1-methylimidazol-4-yl)propanoate (PubChem CID 3080547) has the molecular formula C10H16N4O3
and a molecular weight of 240.26 g/mol. Its IUPAC name is 3-aminopropanoyl (2S)-2-amino-3-(1-methylimidazol-4-yl)propanoate.
Molecular Properties
| Compound Name | 3-aminopropanoyl (2S)-2-amino-3-(1-methylimidazol-4-yl)propanoate |
| PubChem CID | 3080547 |
| Molecular Formula | C10H16N4O3 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | 3-aminopropanoyl (2S)-2-amino-3-(1-methylimidazol-4-yl)propanoate |
| SMILES | Cn1cnc(C[C@H](N)C(=O)OC(=O)CCN)c1 |
| InChI | InChI=1S/C10H16N4O3/c1-14-5-7(13-6-14)4-8(12)10(16)17-9(15)2-3-11/h5-6,8H,2-4,11-12H2,1H3/t8-/m0/s1 |
| InChIKey | QAWKDPXGVJMDHM-QMMMGPOBSA-N |
| XLogP | -1.29 |
| TPSA | 113.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-aminopropanoyl (2S)-2-amino-3-(1-methylimidazol-4-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-aminopropanoyl (2S)-2-amino-3-(1-methylimidazol-4-yl)propanoate?
The IUPAC name of 3-aminopropanoyl (2S)-2-amino-3-(1-methylimidazol-4-yl)propanoate (CID 3080547) is 3-aminopropanoyl (2S)-2-amino-3-(1-methylimidazol-4-yl)propanoate.
What is the SMILES notation for 3-aminopropanoyl (2S)-2-amino-3-(1-methylimidazol-4-yl)propanoate?
The canonical SMILES for 3-aminopropanoyl (2S)-2-amino-3-(1-methylimidazol-4-yl)propanoate is Cn1cnc(C[C@H](N)C(=O)OC(=O)CCN)c1.
What is the InChIKey of 3-aminopropanoyl (2S)-2-amino-3-(1-methylimidazol-4-yl)propanoate?
The InChIKey is QAWKDPXGVJMDHM-QMMMGPOBSA-N. The full InChI is InChI=1S/C10H16N4O3/c1-14-5-7(13-6-14)4-8(12)10(16)17-9(15)2-3-11/h5-6,8H,2-4,11-12H2,1H3/t8-/m0/s1.
What are the key properties of 3-aminopropanoyl (2S)-2-amino-3-(1-methylimidazol-4-yl)propanoate?
3-aminopropanoyl (2S)-2-amino-3-(1-methylimidazol-4-yl)propanoate has a molecular weight of 240.26 g/mol, XLogP of -1.29, 5 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-aminopropanoyl (2S)-2-amino-3-(1-methylimidazol-4-yl)propanoate is sourced from PubChem (CID 3080547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).