C25H30N8O6S — CID 3082510
4-amino-N-(6-methoxypyrimidin-4-yl)benzenesulfonamide;5-[(3,4,5-trimethoxyphenyl)methyl]pyrimidine-2,4-diamine (PubChem CID 3082510) has the molecular formula C25H30N8O6S and a molecular weight of 570.63 g/mol. Its IUPAC name is 4-amino-N-(6-methoxypyrimidin-4-yl)benzenesulfonamide;5-[(3,4,5-trimethoxyphenyl)methyl]pyrimidine-2,4-diamine.
| Compound Name | 4-amino-N-(6-methoxypyrimidin-4-yl)benzenesulfonamide;5-[(3,4,5-trimethoxyphenyl)methyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 3082510 |
| Molecular Formula | C25H30N8O6S |
| Molecular Weight | 570.63 g/mol |
| Exact Mass | 570.20 |
| IUPAC Name | 4-amino-N-(6-methoxypyrimidin-4-yl)benzenesulfonamide;5-[(3,4,5-trimethoxyphenyl)methyl]pyrimidine-2,4-diamine |
| SMILES | COc1cc(Cc2cnc(N)nc2N)cc(OC)c1OC.COc1cc(NS(=O)(=O)c2ccc(N)cc2)ncn1 |
| InChI | InChI=1S/C14H18N4O3.C11H12N4O3S/c1-19-10-5-8(6-11(20-2)12(10)21-3)4-9-7-17-14(16)18-13(9)15;1-18-11-6-10(13-7-14-11)15-19(16,17)9-4-2-8(12)3-5-9/h5-7H,4H2,1-3H3,(H4,15,16,17,18);2-7H,12H2,1H3,(H,13,14,15) |
| InChIKey | MWDPWRUULMQYHY-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 212.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.63 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|