C29H33N5O5S — CID 174478055
5-[[4-[3-[2-(4-aminophenyl)-4-methylsulfonylphenyl]propoxy]-3,5-dimethoxyphenyl]methyl]pyrimidine-2,4-diamine (PubChem CID 174478055) has the molecular formula C29H33N5O5S and a molecular weight of 563.68 g/mol. Its IUPAC name is 5-[[4-[3-[2-(4-aminophenyl)-4-methylsulfonylphenyl]propoxy]-3,5-dimethoxyphenyl]methyl]pyrimidine-2,4-diamine.
| Compound Name | 5-[[4-[3-[2-(4-aminophenyl)-4-methylsulfonylphenyl]propoxy]-3,5-dimethoxyphenyl]methyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 174478055 |
| Molecular Formula | C29H33N5O5S |
| Molecular Weight | 563.68 g/mol |
| Exact Mass | 563.22 |
| IUPAC Name | 5-[[4-[3-[2-(4-aminophenyl)-4-methylsulfonylphenyl]propoxy]-3,5-dimethoxyphenyl]methyl]pyrimidine-2,4-diamine |
| SMILES | COc1cc(Cc2cnc(N)nc2N)cc(OC)c1OCCCc1ccc(S(C)(=O)=O)cc1-c1ccc(N)cc1 |
| InChI | InChI=1S/C29H33N5O5S/c1-37-25-14-18(13-21-17-33-29(32)34-28(21)31)15-26(38-2)27(25)39-12-4-5-19-8-11-23(40(3,35)36)16-24(19)20-6-9-22(30)10-7-20/h6-11,14-17H,4-5,12-13,30H2,1-3H3,(H4,31,32,33,34) |
| InChIKey | DNIQSJOZURUCDY-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 165.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.68 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|