C28H29N5O7S — CID 57204596
4-[3-[4-[(2,4-diaminopyrimidin-5-yl)methyl]-2,6-dimethoxyphenoxy]propyl]-3-(4-nitrophenyl)benzenesulfinic acid (PubChem CID 57204596) has the molecular formula C28H29N5O7S and a molecular weight of 579.64 g/mol. Its IUPAC name is 4-[3-[4-[(2,4-diaminopyrimidin-5-yl)methyl]-2,6-dimethoxyphenoxy]propyl]-3-(4-nitrophenyl)benzenesulfinic acid.
| Compound Name | 4-[3-[4-[(2,4-diaminopyrimidin-5-yl)methyl]-2,6-dimethoxyphenoxy]propyl]-3-(4-nitrophenyl)benzenesulfinic acid |
|---|---|
| PubChem CID | 57204596 |
| Molecular Formula | C28H29N5O7S |
| Molecular Weight | 579.64 g/mol |
| Exact Mass | 579.18 |
| IUPAC Name | 4-[3-[4-[(2,4-diaminopyrimidin-5-yl)methyl]-2,6-dimethoxyphenoxy]propyl]-3-(4-nitrophenyl)benzenesulfinic acid |
| SMILES | COc1cc(Cc2cnc(N)nc2N)cc(OC)c1OCCCc1ccc(S(=O)O)cc1-c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C28H29N5O7S/c1-38-24-13-17(12-20-16-31-28(30)32-27(20)29)14-25(39-2)26(24)40-11-3-4-18-7-10-22(41(36)37)15-23(18)19-5-8-21(9-6-19)33(34)35/h5-10,13-16H,3-4,11-12H2,1-2H3,(H,36,37)(H4,29,30,31,32) |
| InChIKey | IHULUHVYKAIPLB-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 185.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.64 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|