C26H26N6O6S — CID 5276582
5-[[4-methoxy-3-[2-(4-nitro-N-(4-sulfonylcyclohexa-1,5-dien-1-yl)anilino)ethoxy]phenyl]methyl]pyrimidine-2,4-diamine (PubChem CID 5276582) has the molecular formula C26H26N6O6S and a molecular weight of 550.60 g/mol. Its IUPAC name is 5-[[4-methoxy-3-[2-(4-nitro-N-(4-sulfonylcyclohexa-1,5-dien-1-yl)anilino)ethoxy]phenyl]methyl]pyrimidine-2,4-diamine.
| Compound Name | 5-[[4-methoxy-3-[2-(4-nitro-N-(4-sulfonylcyclohexa-1,5-dien-1-yl)anilino)ethoxy]phenyl]methyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 5276582 |
| Molecular Formula | C26H26N6O6S |
| Molecular Weight | 550.60 g/mol |
| Exact Mass | 550.16 |
| IUPAC Name | 5-[[4-methoxy-3-[2-(4-nitro-N-(4-sulfonylcyclohexa-1,5-dien-1-yl)anilino)ethoxy]phenyl]methyl]pyrimidine-2,4-diamine |
| SMILES | COc1ccc(Cc2cnc(N)nc2N)cc1OCCN(C1=CCC(=S(=O)=O)C=C1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C26H26N6O6S/c1-37-23-11-2-17(14-18-16-29-26(28)30-25(18)27)15-24(23)38-13-12-31(19-3-5-21(6-4-19)32(33)34)20-7-9-22(10-8-20)39(35)36/h2-9,11,15-16H,10,12-14H2,1H3,(H4,27,28,29,30) |
| InChIKey | VFHMRMGDBHIJTC-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 176.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.60 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|