C25H23N5O6S — CID 19861022
5-[[4-methoxy-3-[[6-(4-nitrophenyl)-4-sulfonylcyclohexa-1,5-dien-1-yl]methoxy]phenyl]methyl]pyrimidine-2,4-diamine (PubChem CID 19861022) has the molecular formula C25H23N5O6S and a molecular weight of 521.56 g/mol. Its IUPAC name is 5-[[4-methoxy-3-[[6-(4-nitrophenyl)-4-sulfonylcyclohexa-1,5-dien-1-yl]methoxy]phenyl]methyl]pyrimidine-2,4-diamine.
| Compound Name | 5-[[4-methoxy-3-[[6-(4-nitrophenyl)-4-sulfonylcyclohexa-1,5-dien-1-yl]methoxy]phenyl]methyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 19861022 |
| Molecular Formula | C25H23N5O6S |
| Molecular Weight | 521.56 g/mol |
| Exact Mass | 521.14 |
| IUPAC Name | 5-[[4-methoxy-3-[[6-(4-nitrophenyl)-4-sulfonylcyclohexa-1,5-dien-1-yl]methoxy]phenyl]methyl]pyrimidine-2,4-diamine |
| SMILES | COc1ccc(Cc2cnc(N)nc2N)cc1OCC1=CCC(=S(=O)=O)C=C1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C25H23N5O6S/c1-35-22-9-2-15(10-18-13-28-25(27)29-24(18)26)11-23(22)36-14-17-5-8-20(37(33)34)12-21(17)16-3-6-19(7-4-16)30(31)32/h2-7,9,11-13H,8,10,14H2,1H3,(H4,26,27,28,29) |
| InChIKey | GTKDVPVOGMZUBP-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 173.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.56 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|