C18H11NO3S — CID 3084823
8-(2-aminophenyl)sulfanyl-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione (PubChem CID 3084823) has the molecular formula C18H11NO3S and a molecular weight of 321.36 g/mol. Its IUPAC name is 8-(2-aminophenyl)sulfanyl-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione.
| Compound Name | 8-(2-aminophenyl)sulfanyl-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione |
|---|---|
| PubChem CID | 3084823 |
| Molecular Formula | C18H11NO3S |
| Molecular Weight | 321.36 g/mol |
| Exact Mass | 321.05 |
| IUPAC Name | 8-(2-aminophenyl)sulfanyl-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione |
| SMILES | Nc1ccccc1Sc1ccc2c3c(cccc13)C(=O)OC2=O |
| InChI | InChI=1S/C18H11NO3S/c19-13-6-1-2-7-15(13)23-14-9-8-12-16-10(14)4-3-5-11(16)17(20)22-18(12)21/h1-9H,19H2 |
| InChIKey | INCMZXBJTDCMCP-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.36 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|