C18H22N4O5S — CID 30885940
(3-morpholin-4-ylsulfonylphenyl)methyl 2-[methyl(pyrimidin-2-yl)amino]acetate (PubChem CID 30885940) has the molecular formula C18H22N4O5S and a molecular weight of 406.46 g/mol. Its IUPAC name is (3-morpholin-4-ylsulfonylphenyl)methyl 2-[methyl(pyrimidin-2-yl)amino]acetate.
| Compound Name | (3-morpholin-4-ylsulfonylphenyl)methyl 2-[methyl(pyrimidin-2-yl)amino]acetate |
|---|---|
| PubChem CID | 30885940 |
| Molecular Formula | C18H22N4O5S |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | (3-morpholin-4-ylsulfonylphenyl)methyl 2-[methyl(pyrimidin-2-yl)amino]acetate |
| SMILES | CN(CC(=O)OCc1cccc(S(=O)(=O)N2CCOCC2)c1)c1ncccn1 |
| InChI | InChI=1S/C18H22N4O5S/c1-21(18-19-6-3-7-20-18)13-17(23)27-14-15-4-2-5-16(12-15)28(24,25)22-8-10-26-11-9-22/h2-7,12H,8-11,13-14H2,1H3 |
| InChIKey | NOWCKRQXVCMXAZ-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 101.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |