C16H18BrN5O4S — CID 30892749
N'-(4-bromo-1H-pyrrole-2-carbonyl)-1-pyridin-3-ylsulfonylpiperidine-4-carbohydrazide (PubChem CID 30892749) has the molecular formula C16H18BrN5O4S and a molecular weight of 456.32 g/mol. Its IUPAC name is N'-(4-bromo-1H-pyrrole-2-carbonyl)-1-pyridin-3-ylsulfonylpiperidine-4-carbohydrazide.
| Compound Name | N'-(4-bromo-1H-pyrrole-2-carbonyl)-1-pyridin-3-ylsulfonylpiperidine-4-carbohydrazide |
|---|---|
| PubChem CID | 30892749 |
| Molecular Formula | C16H18BrN5O4S |
| Molecular Weight | 456.32 g/mol |
| Exact Mass | 455.03 |
| IUPAC Name | N'-(4-bromo-1H-pyrrole-2-carbonyl)-1-pyridin-3-ylsulfonylpiperidine-4-carbohydrazide |
| SMILES | O=C(NNC(=O)C1CCN(S(=O)(=O)c2cccnc2)CC1)c1cc(Br)c[nH]1 |
| InChI | InChI=1S/C16H18BrN5O4S/c17-12-8-14(19-9-12)16(24)21-20-15(23)11-3-6-22(7-4-11)27(25,26)13-2-1-5-18-10-13/h1-2,5,8-11,19H,3-4,6-7H2,(H,20,23)(H,21,24) |
| InChIKey | RGCNPCMKBGBUIC-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 124.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.32 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|