C20H25N5O6S2 — CID 46407269
N,N-dimethyl-3-[[(1-pyridin-3-ylsulfonylpiperidine-4-carbonyl)amino]carbamoyl]benzenesulfonamide (PubChem CID 46407269) has the molecular formula C20H25N5O6S2 and a molecular weight of 495.58 g/mol. Its IUPAC name is N,N-dimethyl-3-[[(1-pyridin-3-ylsulfonylpiperidine-4-carbonyl)amino]carbamoyl]benzenesulfonamide.
| Compound Name | N,N-dimethyl-3-[[(1-pyridin-3-ylsulfonylpiperidine-4-carbonyl)amino]carbamoyl]benzenesulfonamide |
|---|---|
| PubChem CID | 46407269 |
| Molecular Formula | C20H25N5O6S2 |
| Molecular Weight | 495.58 g/mol |
| Exact Mass | 495.12 |
| IUPAC Name | N,N-dimethyl-3-[[(1-pyridin-3-ylsulfonylpiperidine-4-carbonyl)amino]carbamoyl]benzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1cccc(C(=O)NNC(=O)C2CCN(S(=O)(=O)c3cccnc3)CC2)c1 |
| InChI | InChI=1S/C20H25N5O6S2/c1-24(2)32(28,29)17-6-3-5-16(13-17)20(27)23-22-19(26)15-8-11-25(12-9-15)33(30,31)18-7-4-10-21-14-18/h3-7,10,13-15H,8-9,11-12H2,1-2H3,(H,22,26)(H,23,27) |
| InChIKey | GBRWIXXDOGMTHO-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 145.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.58 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|