C21H32N4O3 — CID 3094103
[[4-[cyclohexylcarbamoyl(methyl)amino]-4-methylpentan-2-ylidene]amino] N-phenylcarbamate (PubChem CID 3094103) has the molecular formula C21H32N4O3 and a molecular weight of 388.51 g/mol. Its IUPAC name is [[4-[cyclohexylcarbamoyl(methyl)amino]-4-methylpentan-2-ylidene]amino] N-phenylcarbamate.
| Compound Name | [[4-[cyclohexylcarbamoyl(methyl)amino]-4-methylpentan-2-ylidene]amino] N-phenylcarbamate |
|---|---|
| PubChem CID | 3094103 |
| Molecular Formula | C21H32N4O3 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.25 |
| IUPAC Name | [[4-[cyclohexylcarbamoyl(methyl)amino]-4-methylpentan-2-ylidene]amino] N-phenylcarbamate |
| SMILES | CC(CC(C)(C)N(C)C(=O)NC1CCCCC1)=NOC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C21H32N4O3/c1-16(24-28-20(27)23-18-13-9-6-10-14-18)15-21(2,3)25(4)19(26)22-17-11-7-5-8-12-17/h6,9-10,13-14,17H,5,7-8,11-12,15H2,1-4H3,(H,22,26)(H,23,27) |
| InChIKey | CEVYAXKXDOLPIL-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|