C15H19N3O3 — CID 6883889
[(E)-(2-anilino-2-oxoethylidene)amino] N-cyclohexylcarbamate (PubChem CID 6883889) has the molecular formula C15H19N3O3 and a molecular weight of 289.33 g/mol. Its IUPAC name is [(E)-(2-anilino-2-oxoethylidene)amino] N-cyclohexylcarbamate.
| Compound Name | [(E)-(2-anilino-2-oxoethylidene)amino] N-cyclohexylcarbamate |
|---|---|
| PubChem CID | 6883889 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | [(E)-(2-anilino-2-oxoethylidene)amino] N-cyclohexylcarbamate |
| SMILES | O=C(/C=N/OC(=O)NC1CCCCC1)Nc1ccccc1 |
| InChI | InChI=1S/C15H19N3O3/c19-14(17-12-7-3-1-4-8-12)11-16-21-15(20)18-13-9-5-2-6-10-13/h1,3-4,7-8,11,13H,2,5-6,9-10H2,(H,17,19)(H,18,20)/b16-11+ |
| InChIKey | RWFILQVBEPSABA-LFIBNONCSA-N |
| XLogP | 2.67 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|