C15H13F7N2O3 — CID 3101252
N'-(5,5,6,6,7,7,7-heptafluoro-4-oxohept-2-en-2-yl)-3-methoxybenzohydrazide (PubChem CID 3101252) has the molecular formula C15H13F7N2O3 and a molecular weight of 402.27 g/mol. Its IUPAC name is N'-(5,5,6,6,7,7,7-heptafluoro-4-oxohept-2-en-2-yl)-3-methoxybenzohydrazide.
| Compound Name | N'-(5,5,6,6,7,7,7-heptafluoro-4-oxohept-2-en-2-yl)-3-methoxybenzohydrazide |
|---|---|
| PubChem CID | 3101252 |
| Molecular Formula | C15H13F7N2O3 |
| Molecular Weight | 402.27 g/mol |
| Exact Mass | 402.08 |
| IUPAC Name | N'-(5,5,6,6,7,7,7-heptafluoro-4-oxohept-2-en-2-yl)-3-methoxybenzohydrazide |
| SMILES | COc1cccc(C(=O)NNC(C)=CC(=O)C(F)(F)C(F)(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C15H13F7N2O3/c1-8(6-11(25)13(16,17)14(18,19)15(20,21)22)23-24-12(26)9-4-3-5-10(7-9)27-2/h3-7,23H,1-2H3,(H,24,26) |
| InChIKey | KNTVPOWEBPJFKR-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.27 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|